C25H44O5 — CID 144612012
(6-ethyl-2,2,4,4-tetramethyloctyl) prop-2-enoate;oxolan-2-ylmethyl prop-2-enoate (PubChem CID 144612012) has the molecular formula C25H44O5 and a molecular weight of 424.62 g/mol. Its IUPAC name is (6-ethyl-2,2,4,4-tetramethyloctyl) prop-2-enoate;oxolan-2-ylmethyl prop-2-enoate.
| Compound Name | (6-ethyl-2,2,4,4-tetramethyloctyl) prop-2-enoate;oxolan-2-ylmethyl prop-2-enoate |
|---|---|
| PubChem CID | 144612012 |
| Molecular Formula | C25H44O5 |
| Molecular Weight | 424.62 g/mol |
| Exact Mass | 424.32 |
| IUPAC Name | (6-ethyl-2,2,4,4-tetramethyloctyl) prop-2-enoate;oxolan-2-ylmethyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)(C)CC(C)(C)CC(CC)CC.C=CC(=O)OCC1CCCO1 |
| InChI | InChI=1S/C17H32O2.C8H12O3/c1-8-14(9-2)11-16(4,5)12-17(6,7)13-19-15(18)10-3;1-2-8(9)11-6-7-4-3-5-10-7/h10,14H,3,8-9,11-13H2,1-2,4-7H3;2,7H,1,3-6H2 |
| InChIKey | JEDZCTJEMAYPLC-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.62 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|