About O-(oxolan-2-ylmethyl) ethanethioate
O-(oxolan-2-ylmethyl) ethanethioate (PubChem CID 91101390) has the molecular formula C7H12O2S
and a molecular weight of 160.24 g/mol. Its IUPAC name is O-(oxolan-2-ylmethyl) ethanethioate.
Molecular Properties
| Compound Name | O-(oxolan-2-ylmethyl) ethanethioate |
| PubChem CID | 91101390 |
| Molecular Formula | C7H12O2S |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | O-(oxolan-2-ylmethyl) ethanethioate |
| SMILES | CC(=S)OCC1CCCO1 |
| InChI | InChI=1S/C7H12O2S/c1-6(10)9-5-7-3-2-4-8-7/h7H,2-5H2,1H3 |
| InChIKey | YKQQOLFYRCOOIC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(oxolan-2-ylmethyl) ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(oxolan-2-ylmethyl) ethanethioate?
The IUPAC name of O-(oxolan-2-ylmethyl) ethanethioate (CID 91101390) is O-(oxolan-2-ylmethyl) ethanethioate.
What is the SMILES notation for O-(oxolan-2-ylmethyl) ethanethioate?
The canonical SMILES for O-(oxolan-2-ylmethyl) ethanethioate is CC(=S)OCC1CCCO1.
What is the InChIKey of O-(oxolan-2-ylmethyl) ethanethioate?
The InChIKey is YKQQOLFYRCOOIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2S/c1-6(10)9-5-7-3-2-4-8-7/h7H,2-5H2,1H3.
What are the key properties of O-(oxolan-2-ylmethyl) ethanethioate?
O-(oxolan-2-ylmethyl) ethanethioate has a molecular weight of 160.24 g/mol, XLogP of 1.53, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-(oxolan-2-ylmethyl) ethanethioate is sourced from PubChem (CID 91101390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).