About oxan-2-ylmethyl N-[1-(dimethyl-λ3-iodanyl)-1-oxobutan-2-yl]carbamate
oxan-2-ylmethyl N-[1-(dimethyl-λ3-iodanyl)-1-oxobutan-2-yl]carbamate (PubChem CID 163630487) has the molecular formula C13H24INO4
and a molecular weight of 385.24 g/mol. Its IUPAC name is oxan-2-ylmethyl N-[1-(dimethyl-λ3-iodanyl)-1-oxobutan-2-yl]carbamate.
Molecular Properties
| Compound Name | oxan-2-ylmethyl N-[1-(dimethyl-λ3-iodanyl)-1-oxobutan-2-yl]carbamate |
| PubChem CID | 163630487 |
| Molecular Formula | C13H24INO4 |
| Molecular Weight | 385.24 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | oxan-2-ylmethyl N-[1-(dimethyl-λ3-iodanyl)-1-oxobutan-2-yl]carbamate |
| SMILES | CCC(NC(=O)OCC1CCCCO1)C(=O)I(C)C |
| InChI | InChI=1S/C13H24INO4/c1-4-11(12(16)14(2)3)15-13(17)19-9-10-7-5-6-8-18-10/h10-11H,4-9H2,1-3H3,(H,15,17) |
| InChIKey | HVQDIXPEXZKNST-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze oxan-2-ylmethyl N-[1-(dimethyl-λ3-iodanyl)-1-oxobutan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-2-ylmethyl N-[1-(dimethyl-λ3-iodanyl)-1-oxobutan-2-yl]carbamate?
The IUPAC name of oxan-2-ylmethyl N-[1-(dimethyl-λ3-iodanyl)-1-oxobutan-2-yl]carbamate (CID 163630487) is oxan-2-ylmethyl N-[1-(dimethyl-λ3-iodanyl)-1-oxobutan-2-yl]carbamate.
What is the SMILES notation for oxan-2-ylmethyl N-[1-(dimethyl-λ3-iodanyl)-1-oxobutan-2-yl]carbamate?
The canonical SMILES for oxan-2-ylmethyl N-[1-(dimethyl-λ3-iodanyl)-1-oxobutan-2-yl]carbamate is CCC(NC(=O)OCC1CCCCO1)C(=O)I(C)C.
What is the InChIKey of oxan-2-ylmethyl N-[1-(dimethyl-λ3-iodanyl)-1-oxobutan-2-yl]carbamate?
The InChIKey is HVQDIXPEXZKNST-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24INO4/c1-4-11(12(16)14(2)3)15-13(17)19-9-10-7-5-6-8-18-10/h10-11H,4-9H2,1-3H3,(H,15,17).
What are the key properties of oxan-2-ylmethyl N-[1-(dimethyl-λ3-iodanyl)-1-oxobutan-2-yl]carbamate?
oxan-2-ylmethyl N-[1-(dimethyl-λ3-iodanyl)-1-oxobutan-2-yl]carbamate has a molecular weight of 385.24 g/mol, XLogP of 2.35, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-2-ylmethyl N-[1-(dimethyl-λ3-iodanyl)-1-oxobutan-2-yl]carbamate is sourced from PubChem (CID 163630487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).