About [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride
[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride (PubChem CID 122155414) has the molecular formula C17H33ClN2O3
and a molecular weight of 348.92 g/mol. Its IUPAC name is [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride.
Molecular Properties
| Compound Name | [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride |
| PubChem CID | 122155414 |
| Molecular Formula | C17H33ClN2O3 |
| Molecular Weight | 348.92 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride |
| SMILES | CC(C)C[C@H](CN)CC(=O)OCC(=O)N1C(C)CCCC1C.Cl |
| InChI | InChI=1S/C17H32N2O3.ClH/c1-12(2)8-15(10-18)9-17(21)22-11-16(20)19-13(3)6-5-7-14(19)4;/h12-15H,5-11,18H2,1-4H3;1H/t13?,14?,15-;/m0./s1 |
| InChIKey | JRCCTJMZHFTGIM-PRBKGMBASA-N |
| XLogP | 2.75 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.92 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride?
The IUPAC name of [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride (CID 122155414) is [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride.
What is the SMILES notation for [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride?
The canonical SMILES for [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride is CC(C)C[C@H](CN)CC(=O)OCC(=O)N1C(C)CCCC1C.Cl.
What is the InChIKey of [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride?
The InChIKey is JRCCTJMZHFTGIM-PRBKGMBASA-N. The full InChI is InChI=1S/C17H32N2O3.ClH/c1-12(2)8-15(10-18)9-17(21)22-11-16(20)19-13(3)6-5-7-14(19)4;/h12-15H,5-11,18H2,1-4H3;1H/t13?,14?,15-;/m0./s1.
What are the key properties of [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride?
[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride has a molecular weight of 348.92 g/mol, XLogP of 2.75, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride is sourced from PubChem (CID 122155414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).