C11H20N2O2 — CID 125421988
[(1S)-1-cyanoethyl] (3S)-3-(aminomethyl)-5-methylhexanoate (PubChem CID 125421988) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is [(1S)-1-cyanoethyl] (3S)-3-(aminomethyl)-5-methylhexanoate.
| Compound Name | [(1S)-1-cyanoethyl] (3S)-3-(aminomethyl)-5-methylhexanoate |
|---|---|
| PubChem CID | 125421988 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | [(1S)-1-cyanoethyl] (3S)-3-(aminomethyl)-5-methylhexanoate |
| SMILES | CC(C)C[C@H](CN)CC(=O)O[C@@H](C)C#N |
| InChI | InChI=1S/C11H20N2O2/c1-8(2)4-10(7-13)5-11(14)15-9(3)6-12/h8-10H,4-5,7,13H2,1-3H3/t9-,10-/m0/s1 |
| InChIKey | KJFHCNPTOKZRTN-UWVGGRQHSA-N |
| XLogP | 1.45 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |