About 3-methylbutan-2-yl 2-[(2R)-2-nitrooxypropoxy]ethyl carbonate
3-methylbutan-2-yl 2-[(2R)-2-nitrooxypropoxy]ethyl carbonate (PubChem CID 59614831) has the molecular formula C11H21NO7
and a molecular weight of 279.29 g/mol. Its IUPAC name is 3-methylbutan-2-yl 2-[(2R)-2-nitrooxypropoxy]ethyl carbonate.
Molecular Properties
| Compound Name | 3-methylbutan-2-yl 2-[(2R)-2-nitrooxypropoxy]ethyl carbonate |
| PubChem CID | 59614831 |
| Molecular Formula | C11H21NO7 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 3-methylbutan-2-yl 2-[(2R)-2-nitrooxypropoxy]ethyl carbonate |
| SMILES | CC(C)C(C)OC(=O)OCCOC[C@@H](C)O[N+](=O)[O-] |
| InChI | InChI=1S/C11H21NO7/c1-8(2)10(4)18-11(13)17-6-5-16-7-9(3)19-12(14)15/h8-10H,5-7H2,1-4H3/t9-,10?/m1/s1 |
| InChIKey | PKAIKGHKDAKLSS-YHMJZVADSA-N |
| XLogP | 1.80 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutan-2-yl 2-[(2R)-2-nitrooxypropoxy]ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutan-2-yl 2-[(2R)-2-nitrooxypropoxy]ethyl carbonate?
The IUPAC name of 3-methylbutan-2-yl 2-[(2R)-2-nitrooxypropoxy]ethyl carbonate (CID 59614831) is 3-methylbutan-2-yl 2-[(2R)-2-nitrooxypropoxy]ethyl carbonate.
What is the SMILES notation for 3-methylbutan-2-yl 2-[(2R)-2-nitrooxypropoxy]ethyl carbonate?
The canonical SMILES for 3-methylbutan-2-yl 2-[(2R)-2-nitrooxypropoxy]ethyl carbonate is CC(C)C(C)OC(=O)OCCOC[C@@H](C)O[N+](=O)[O-].
What is the InChIKey of 3-methylbutan-2-yl 2-[(2R)-2-nitrooxypropoxy]ethyl carbonate?
The InChIKey is PKAIKGHKDAKLSS-YHMJZVADSA-N. The full InChI is InChI=1S/C11H21NO7/c1-8(2)10(4)18-11(13)17-6-5-16-7-9(3)19-12(14)15/h8-10H,5-7H2,1-4H3/t9-,10?/m1/s1.
What are the key properties of 3-methylbutan-2-yl 2-[(2R)-2-nitrooxypropoxy]ethyl carbonate?
3-methylbutan-2-yl 2-[(2R)-2-nitrooxypropoxy]ethyl carbonate has a molecular weight of 279.29 g/mol, XLogP of 1.80, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutan-2-yl 2-[(2R)-2-nitrooxypropoxy]ethyl carbonate is sourced from PubChem (CID 59614831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).