About 1-(2-butoxypropoxy)butane;1-butoxypropyl nitrate;nitric acid
1-(2-butoxypropoxy)butane;1-butoxypropyl nitrate;nitric acid (PubChem CID 87507482) has the molecular formula C18H40N2O9
and a molecular weight of 428.52 g/mol. Its IUPAC name is 1-(2-butoxypropoxy)butane;1-butoxypropyl nitrate;nitric acid.
Molecular Properties
| Compound Name | 1-(2-butoxypropoxy)butane;1-butoxypropyl nitrate;nitric acid |
| PubChem CID | 87507482 |
| Molecular Formula | C18H40N2O9 |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | 1-(2-butoxypropoxy)butane;1-butoxypropyl nitrate;nitric acid |
| SMILES | CCCCOC(CC)O[N+](=O)[O-].CCCCOCC(C)OCCCC.O=[N+]([O-])O |
| InChI | InChI=1S/C11H24O2.C7H15NO4.HNO3/c1-4-6-8-12-10-11(3)13-9-7-5-2;1-3-5-6-11-7(4-2)12-8(9)10;2-1(3)4/h11H,4-10H2,1-3H3;7H,3-6H2,1-2H3;(H,2,3,4) |
| InChIKey | XZJAJLJWRWTRNU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 143.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-butoxypropoxy)butane;1-butoxypropyl nitrate;nitric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-butoxypropoxy)butane;1-butoxypropyl nitrate;nitric acid?
The IUPAC name of 1-(2-butoxypropoxy)butane;1-butoxypropyl nitrate;nitric acid (CID 87507482) is 1-(2-butoxypropoxy)butane;1-butoxypropyl nitrate;nitric acid.
What is the SMILES notation for 1-(2-butoxypropoxy)butane;1-butoxypropyl nitrate;nitric acid?
The canonical SMILES for 1-(2-butoxypropoxy)butane;1-butoxypropyl nitrate;nitric acid is CCCCOC(CC)O[N+](=O)[O-].CCCCOCC(C)OCCCC.O=[N+]([O-])O.
What is the InChIKey of 1-(2-butoxypropoxy)butane;1-butoxypropyl nitrate;nitric acid?
The InChIKey is XZJAJLJWRWTRNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O2.C7H15NO4.HNO3/c1-4-6-8-12-10-11(3)13-9-7-5-2;1-3-5-6-11-7(4-2)12-8(9)10;2-1(3)4/h11H,4-10H2,1-3H3;7H,3-6H2,1-2H3;(H,2,3,4).
What are the key properties of 1-(2-butoxypropoxy)butane;1-butoxypropyl nitrate;nitric acid?
1-(2-butoxypropoxy)butane;1-butoxypropyl nitrate;nitric acid has a molecular weight of 428.52 g/mol, XLogP of 4.41, 16 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-butoxypropoxy)butane;1-butoxypropyl nitrate;nitric acid is sourced from PubChem (CID 87507482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).