C10H22N4O11 — CID 87323182
6-methyl-3,7-dinitrononan-4-ol;bis(nitric acid) (PubChem CID 87323182) has the molecular formula C10H22N4O11 and a molecular weight of 374.30 g/mol. Its IUPAC name is 6-methyl-3,7-dinitrononan-4-ol;bis(nitric acid).
| Compound Name | 6-methyl-3,7-dinitrononan-4-ol;bis(nitric acid) |
|---|---|
| PubChem CID | 87323182 |
| Molecular Formula | C10H22N4O11 |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 6-methyl-3,7-dinitrononan-4-ol;bis(nitric acid) |
| SMILES | CCC(C(C)CC(O)C(CC)[N+](=O)[O-])[N+](=O)[O-].O=[N+]([O-])O.O=[N+]([O-])O |
| InChI | InChI=1S/C10H20N2O5.2HNO3/c1-4-8(11(14)15)7(3)6-10(13)9(5-2)12(16)17;2*2-1(3)4/h7-10,13H,4-6H2,1-3H3;2*(H,2,3,4) |
| InChIKey | IBEGZLSEFSBZTQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 233.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|