About copper;1-[2-[bis(2-hydroxypropyl)amino]ethyl-(2-hydroxypropyl)amino]propan-2-ol;nitrate
copper;1-[2-[bis(2-hydroxypropyl)amino]ethyl-(2-hydroxypropyl)amino]propan-2-ol;nitrate (PubChem CID 5351947) has the molecular formula C14H32CuN3O7+
and a molecular weight of 417.97 g/mol. Its IUPAC name is copper;1-[2-[bis(2-hydroxypropyl)amino]ethyl-(2-hydroxypropyl)amino]propan-2-ol;nitrate.
Molecular Properties
| Compound Name | copper;1-[2-[bis(2-hydroxypropyl)amino]ethyl-(2-hydroxypropyl)amino]propan-2-ol;nitrate |
| PubChem CID | 5351947 |
| Molecular Formula | C14H32CuN3O7+ |
| Molecular Weight | 417.97 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | copper;1-[2-[bis(2-hydroxypropyl)amino]ethyl-(2-hydroxypropyl)amino]propan-2-ol;nitrate |
| SMILES | CC(O)CN(CCN(CC(C)O)CC(C)O)CC(C)O.O=[N+]([O-])[O-].[Cu+2] |
| InChI | InChI=1S/C14H32N2O4.Cu.NO3/c1-11(17)7-15(8-12(2)18)5-6-16(9-13(3)19)10-14(4)20;;2-1(3)4/h11-14,17-20H,5-10H2,1-4H3;;/q;+2;-1 |
| InChIKey | OJIOOXUWZIMSNQ-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 153.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.97 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze copper;1-[2-[bis(2-hydroxypropyl)amino]ethyl-(2-hydroxypropyl)amino]propan-2-ol;nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;1-[2-[bis(2-hydroxypropyl)amino]ethyl-(2-hydroxypropyl)amino]propan-2-ol;nitrate?
The IUPAC name of copper;1-[2-[bis(2-hydroxypropyl)amino]ethyl-(2-hydroxypropyl)amino]propan-2-ol;nitrate (CID 5351947) is copper;1-[2-[bis(2-hydroxypropyl)amino]ethyl-(2-hydroxypropyl)amino]propan-2-ol;nitrate.
What is the SMILES notation for copper;1-[2-[bis(2-hydroxypropyl)amino]ethyl-(2-hydroxypropyl)amino]propan-2-ol;nitrate?
The canonical SMILES for copper;1-[2-[bis(2-hydroxypropyl)amino]ethyl-(2-hydroxypropyl)amino]propan-2-ol;nitrate is CC(O)CN(CCN(CC(C)O)CC(C)O)CC(C)O.O=[N+]([O-])[O-].[Cu+2].
What is the InChIKey of copper;1-[2-[bis(2-hydroxypropyl)amino]ethyl-(2-hydroxypropyl)amino]propan-2-ol;nitrate?
The InChIKey is OJIOOXUWZIMSNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32N2O4.Cu.NO3/c1-11(17)7-15(8-12(2)18)5-6-16(9-13(3)19)10-14(4)20;;2-1(3)4/h11-14,17-20H,5-10H2,1-4H3;;/q;+2;-1.
What are the key properties of copper;1-[2-[bis(2-hydroxypropyl)amino]ethyl-(2-hydroxypropyl)amino]propan-2-ol;nitrate?
copper;1-[2-[bis(2-hydroxypropyl)amino]ethyl-(2-hydroxypropyl)amino]propan-2-ol;nitrate has a molecular weight of 417.97 g/mol, XLogP of -1.13, 11 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for copper;1-[2-[bis(2-hydroxypropyl)amino]ethyl-(2-hydroxypropyl)amino]propan-2-ol;nitrate is sourced from PubChem (CID 5351947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).