C9H23NO8P2 — CID 21430077
[3-[bis(2-hydroxypropyl)amino]-1-phosphonopropyl]phosphonic acid (PubChem CID 21430077) has the molecular formula C9H23NO8P2 and a molecular weight of 335.23 g/mol. Its IUPAC name is [3-[bis(2-hydroxypropyl)amino]-1-phosphonopropyl]phosphonic acid.
| Compound Name | [3-[bis(2-hydroxypropyl)amino]-1-phosphonopropyl]phosphonic acid |
|---|---|
| PubChem CID | 21430077 |
| Molecular Formula | C9H23NO8P2 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | [3-[bis(2-hydroxypropyl)amino]-1-phosphonopropyl]phosphonic acid |
| SMILES | CC(O)CN(CCC(P(=O)(O)O)P(=O)(O)O)CC(C)O |
| InChI | InChI=1S/C9H23NO8P2/c1-7(11)5-10(6-8(2)12)4-3-9(19(13,14)15)20(16,17)18/h7-9,11-12H,3-6H2,1-2H3,(H2,13,14,15)(H2,16,17,18) |
| InChIKey | VKBRAJQLZCIELO-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 158.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|