C19H43CuN3O9S — CID 54611426
copper;1-[bis[2-[bis(2-hydroxypropyl)amino]ethyl]amino]propan-2-ol;sulfate (PubChem CID 54611426) has the molecular formula C19H43CuN3O9S and a molecular weight of 553.18 g/mol. Its IUPAC name is copper;1-[bis[2-[bis(2-hydroxypropyl)amino]ethyl]amino]propan-2-ol;sulfate.
| Compound Name | copper;1-[bis[2-[bis(2-hydroxypropyl)amino]ethyl]amino]propan-2-ol;sulfate |
|---|---|
| PubChem CID | 54611426 |
| Molecular Formula | C19H43CuN3O9S |
| Molecular Weight | 553.18 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | copper;1-[bis[2-[bis(2-hydroxypropyl)amino]ethyl]amino]propan-2-ol;sulfate |
| SMILES | CC(O)CN(CCN(CC(C)O)CC(C)O)CCN(CC(C)O)CC(C)O.O=S(=O)([O-])[O-].[Cu+2] |
| InChI | InChI=1S/C19H43N3O5.Cu.H2O4S/c1-15(23)10-20(6-8-21(11-16(2)24)12-17(3)25)7-9-22(13-18(4)26)14-19(5)27;;1-5(2,3)4/h15-19,23-27H,6-14H2,1-5H3;;(H2,1,2,3,4)/q;+2;/p-2 |
| InChIKey | MVHUOBWHKCXXDD-UHFFFAOYSA-L |
| XLogP | -2.54 |
| TPSA | 191.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.18 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|