About 2-bromo-1,1-dinitropropane
2-bromo-1,1-dinitropropane (PubChem CID 174675977) has the molecular formula C3H5BrN2O4
and a molecular weight of 212.99 g/mol. Its IUPAC name is 2-bromo-1,1-dinitropropane.
Molecular Properties
| Compound Name | 2-bromo-1,1-dinitropropane |
| PubChem CID | 174675977 |
| Molecular Formula | C3H5BrN2O4 |
| Molecular Weight | 212.99 g/mol |
| Exact Mass | 211.94 |
| IUPAC Name | 2-bromo-1,1-dinitropropane |
| SMILES | CC(Br)C([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C3H5BrN2O4/c1-2(4)3(5(7)8)6(9)10/h2-3H,1H3 |
| InChIKey | QTWVMWSONVLMEM-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.99 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1,1-dinitropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1,1-dinitropropane?
The IUPAC name of 2-bromo-1,1-dinitropropane (CID 174675977) is 2-bromo-1,1-dinitropropane.
What is the SMILES notation for 2-bromo-1,1-dinitropropane?
The canonical SMILES for 2-bromo-1,1-dinitropropane is CC(Br)C([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of 2-bromo-1,1-dinitropropane?
The InChIKey is QTWVMWSONVLMEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5BrN2O4/c1-2(4)3(5(7)8)6(9)10/h2-3H,1H3.
What are the key properties of 2-bromo-1,1-dinitropropane?
2-bromo-1,1-dinitropropane has a molecular weight of 212.99 g/mol, XLogP of 0.65, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1,1-dinitropropane is sourced from PubChem (CID 174675977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).