C7H19N3O12 — CID 173206500
ethene;tris(nitric acid);propane-1,2,3-triol (PubChem CID 173206500) has the molecular formula C7H19N3O12 and a molecular weight of 337.24 g/mol. Its IUPAC name is ethene;tris(nitric acid);propane-1,2,3-triol.
| Compound Name | ethene;tris(nitric acid);propane-1,2,3-triol |
|---|---|
| PubChem CID | 173206500 |
| Molecular Formula | C7H19N3O12 |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | ethene;tris(nitric acid);propane-1,2,3-triol |
| SMILES | C=C.C=C.O=[N+]([O-])O.O=[N+]([O-])O.O=[N+]([O-])O.OCC(O)CO |
| InChI | InChI=1S/C3H8O3.2C2H4.3HNO3/c4-1-3(6)2-5;2*1-2;3*2-1(3)4/h3-6H,1-2H2;2*1-2H2;3*(H,2,3,4) |
| InChIKey | RQTVDBJZAPRZPS-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 250.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|