C19H22O3 — CID 162931197
4-[(3S)-3-hydroxy-7-phenylhept-6-enyl]benzene-1,2-diol (PubChem CID 162931197) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is 4-[(3S)-3-hydroxy-7-phenylhept-6-enyl]benzene-1,2-diol.
| Compound Name | 4-[(3S)-3-hydroxy-7-phenylhept-6-enyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 162931197 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 4-[(3S)-3-hydroxy-7-phenylhept-6-enyl]benzene-1,2-diol |
| SMILES | Oc1ccc(CC[C@@H](O)CCC=Cc2ccccc2)cc1O |
| InChI | InChI=1S/C19H22O3/c20-17(9-5-4-8-15-6-2-1-3-7-15)12-10-16-11-13-18(21)19(22)14-16/h1-4,6-8,11,13-14,17,20-22H,5,9-10,12H2/t17-/m0/s1 |
| InChIKey | OELWYQGRQUQQPD-KRWDZBQOSA-N |
| XLogP | 3.88 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|