C14H22O4 — CID 23313285
5-[5-(2-methoxyethoxy)pentyl]benzene-1,3-diol (PubChem CID 23313285) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is 5-[5-(2-methoxyethoxy)pentyl]benzene-1,3-diol.
| Compound Name | 5-[5-(2-methoxyethoxy)pentyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 23313285 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 5-[5-(2-methoxyethoxy)pentyl]benzene-1,3-diol |
| SMILES | COCCOCCCCCc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C14H22O4/c1-17-7-8-18-6-4-2-3-5-12-9-13(15)11-14(16)10-12/h9-11,15-16H,2-8H2,1H3 |
| InChIKey | STBQBJUMARYVHL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|