C17H28O2S2 — CID 15052400
4-(8-methoxyoctyl)-2,6-bis(methylsulfanyl)phenol (PubChem CID 15052400) has the molecular formula C17H28O2S2 and a molecular weight of 328.54 g/mol. Its IUPAC name is 4-(8-methoxyoctyl)-2,6-bis(methylsulfanyl)phenol.
| Compound Name | 4-(8-methoxyoctyl)-2,6-bis(methylsulfanyl)phenol |
|---|---|
| PubChem CID | 15052400 |
| Molecular Formula | C17H28O2S2 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 4-(8-methoxyoctyl)-2,6-bis(methylsulfanyl)phenol |
| SMILES | COCCCCCCCCc1cc(SC)c(O)c(SC)c1 |
| InChI | InChI=1S/C17H28O2S2/c1-19-11-9-7-5-4-6-8-10-14-12-15(20-2)17(18)16(13-14)21-3/h12-13,18H,4-11H2,1-3H3 |
| InChIKey | ZYJJACWFAOMILV-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|