C17H28OS2 — CID 15052387
2-methoxy-1,3-bis(methylsulfanyl)-5-octylbenzene (PubChem CID 15052387) has the molecular formula C17H28OS2 and a molecular weight of 312.54 g/mol. Its IUPAC name is 2-methoxy-1,3-bis(methylsulfanyl)-5-octylbenzene.
| Compound Name | 2-methoxy-1,3-bis(methylsulfanyl)-5-octylbenzene |
|---|---|
| PubChem CID | 15052387 |
| Molecular Formula | C17H28OS2 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-methoxy-1,3-bis(methylsulfanyl)-5-octylbenzene |
| SMILES | CCCCCCCCc1cc(SC)c(OC)c(SC)c1 |
| InChI | InChI=1S/C17H28OS2/c1-5-6-7-8-9-10-11-14-12-15(19-3)17(18-2)16(13-14)20-4/h12-13H,5-11H2,1-4H3 |
| InChIKey | PVXGUDSVCSTLLC-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|