C7H7NO5S — CID 19389206
5-formyl-1,2-dihydroxy-3-(sulfinoamino)benzene (PubChem CID 19389206) has the molecular formula C7H7NO5S and a molecular weight of 217.20 g/mol. Its IUPAC name is 5-formyl-1,2-dihydroxy-3-(sulfinoamino)benzene.
| Compound Name | 5-formyl-1,2-dihydroxy-3-(sulfinoamino)benzene |
|---|---|
| PubChem CID | 19389206 |
| Molecular Formula | C7H7NO5S |
| Molecular Weight | 217.20 g/mol |
| Exact Mass | 217.00 |
| IUPAC Name | 5-formyl-1,2-dihydroxy-3-(sulfinoamino)benzene |
| SMILES | O=Cc1cc(O)c(O)c(NS(=O)O)c1 |
| InChI | InChI=1S/C7H7NO5S/c9-3-4-1-5(8-14(12)13)7(11)6(10)2-4/h1-3,8,10-11H,(H,12,13) |
| InChIKey | SOEQPUSDOLSDJL-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.20 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|