C8H7NO3 — CID 89278694
5-amino-4-hydroxybenzene-1,3-dicarbaldehyde (PubChem CID 89278694) has the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. Its IUPAC name is 5-amino-4-hydroxybenzene-1,3-dicarbaldehyde.
| Compound Name | 5-amino-4-hydroxybenzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 89278694 |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 5-amino-4-hydroxybenzene-1,3-dicarbaldehyde |
| SMILES | Nc1cc(C=O)cc(C=O)c1O |
| InChI | InChI=1S/C8H7NO3/c9-7-2-5(3-10)1-6(4-11)8(7)12/h1-4,12H,9H2 |
| InChIKey | KRUBARHAISDGCY-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|