C13H8F4O3 — CID 159523746
3,5-difluoro-2-hydroxybenzaldehyde;2,4-difluorophenol (PubChem CID 159523746) has the molecular formula C13H8F4O3 and a molecular weight of 288.20 g/mol. Its IUPAC name is 3,5-difluoro-2-hydroxybenzaldehyde;2,4-difluorophenol.
| Compound Name | 3,5-difluoro-2-hydroxybenzaldehyde;2,4-difluorophenol |
|---|---|
| PubChem CID | 159523746 |
| Molecular Formula | C13H8F4O3 |
| Molecular Weight | 288.20 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 3,5-difluoro-2-hydroxybenzaldehyde;2,4-difluorophenol |
| SMILES | O=Cc1cc(F)cc(F)c1O.Oc1ccc(F)cc1F |
| InChI | InChI=1S/C7H4F2O2.C6H4F2O/c8-5-1-4(3-10)7(11)6(9)2-5;7-4-1-2-6(9)5(8)3-4/h1-3,11H;1-3,9H |
| InChIKey | MCDANIVLSUZUHR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.20 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|