C14H14Cl2F6 — CID 156749474
1,3-dichloro-5-(2,3,4,4,5,5-hexafluoro-2-methylhexan-3-yl)-2-methylbenzene (PubChem CID 156749474) has the molecular formula C14H14Cl2F6 and a molecular weight of 367.16 g/mol. Its IUPAC name is 1,3-dichloro-5-(2,3,4,4,5,5-hexafluoro-2-methylhexan-3-yl)-2-methylbenzene.
| Compound Name | 1,3-dichloro-5-(2,3,4,4,5,5-hexafluoro-2-methylhexan-3-yl)-2-methylbenzene |
|---|---|
| PubChem CID | 156749474 |
| Molecular Formula | C14H14Cl2F6 |
| Molecular Weight | 367.16 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 1,3-dichloro-5-(2,3,4,4,5,5-hexafluoro-2-methylhexan-3-yl)-2-methylbenzene |
| SMILES | Cc1c(Cl)cc(C(F)(C(C)(C)F)C(F)(F)C(C)(F)F)cc1Cl |
| InChI | InChI=1S/C14H14Cl2F6/c1-7-9(15)5-8(6-10(7)16)13(20,11(2,3)17)14(21,22)12(4,18)19/h5-6H,1-4H3 |
| InChIKey | MCVAESQNYJWETG-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.16 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|