C8H6Cl2OS — CID 87864028
2,6-dichloro-4-methylsulfanylbenzaldehyde (PubChem CID 87864028) has the molecular formula C8H6Cl2OS and a molecular weight of 221.11 g/mol. Its IUPAC name is 2,6-dichloro-4-methylsulfanylbenzaldehyde.
| Compound Name | 2,6-dichloro-4-methylsulfanylbenzaldehyde |
|---|---|
| PubChem CID | 87864028 |
| Molecular Formula | C8H6Cl2OS |
| Molecular Weight | 221.11 g/mol |
| Exact Mass | 219.95 |
| IUPAC Name | 2,6-dichloro-4-methylsulfanylbenzaldehyde |
| SMILES | CSc1cc(Cl)c(C=O)c(Cl)c1 |
| InChI | InChI=1S/C8H6Cl2OS/c1-12-5-2-7(9)6(4-11)8(10)3-5/h2-4H,1H3 |
| InChIKey | XLHQQQHYKGOWAZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.11 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|