C16H11Cl2NOS — CID 4564550
4,6-dichloro-2-(4-methylsulfanylphenyl)-1H-indole-3-carbaldehyde (PubChem CID 4564550) has the molecular formula C16H11Cl2NOS and a molecular weight of 336.24 g/mol. Its IUPAC name is 4,6-dichloro-2-(4-methylsulfanylphenyl)-1H-indole-3-carbaldehyde.
| Compound Name | 4,6-dichloro-2-(4-methylsulfanylphenyl)-1H-indole-3-carbaldehyde |
|---|---|
| PubChem CID | 4564550 |
| Molecular Formula | C16H11Cl2NOS |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | 4,6-dichloro-2-(4-methylsulfanylphenyl)-1H-indole-3-carbaldehyde |
| SMILES | CSc1ccc(-c2[nH]c3cc(Cl)cc(Cl)c3c2C=O)cc1 |
| InChI | InChI=1S/C16H11Cl2NOS/c1-21-11-4-2-9(3-5-11)16-12(8-20)15-13(18)6-10(17)7-14(15)19-16/h2-8,19H,1H3 |
| InChIKey | HSMANVYTSZJOIN-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|