C16H9Cl2FN2O2 — CID 6288139
4,6-dichloro-2-(4-fluorophenyl)-3-[(E)-2-nitroethenyl]-1H-indole (PubChem CID 6288139) has the molecular formula C16H9Cl2FN2O2 and a molecular weight of 351.16 g/mol. Its IUPAC name is 4,6-dichloro-2-(4-fluorophenyl)-3-[(E)-2-nitroethenyl]-1H-indole.
| Compound Name | 4,6-dichloro-2-(4-fluorophenyl)-3-[(E)-2-nitroethenyl]-1H-indole |
|---|---|
| PubChem CID | 6288139 |
| Molecular Formula | C16H9Cl2FN2O2 |
| Molecular Weight | 351.16 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 4,6-dichloro-2-(4-fluorophenyl)-3-[(E)-2-nitroethenyl]-1H-indole |
| SMILES | O=[N+]([O-])/C=C/c1c(-c2ccc(F)cc2)[nH]c2cc(Cl)cc(Cl)c12 |
| InChI | InChI=1S/C16H9Cl2FN2O2/c17-10-7-13(18)15-12(5-6-21(22)23)16(20-14(15)8-10)9-1-3-11(19)4-2-9/h1-8,20H/b6-5+ |
| InChIKey | SIVAVCSTMOULNR-AATRIKPKSA-N |
| XLogP | 5.53 |
| TPSA | 58.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.16 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|