C22H20FN3O6 — CID 174533867
[6-fluoro-2-[4-[[methoxycarbonyl(methyl)amino]methyl]phenyl]-3-[(E)-2-nitroethenyl]-1H-indol-4-yl] acetate (PubChem CID 174533867) has the molecular formula C22H20FN3O6 and a molecular weight of 441.42 g/mol. Its IUPAC name is [6-fluoro-2-[4-[[methoxycarbonyl(methyl)amino]methyl]phenyl]-3-[(E)-2-nitroethenyl]-1H-indol-4-yl] acetate.
| Compound Name | [6-fluoro-2-[4-[[methoxycarbonyl(methyl)amino]methyl]phenyl]-3-[(E)-2-nitroethenyl]-1H-indol-4-yl] acetate |
|---|---|
| PubChem CID | 174533867 |
| Molecular Formula | C22H20FN3O6 |
| Molecular Weight | 441.42 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | [6-fluoro-2-[4-[[methoxycarbonyl(methyl)amino]methyl]phenyl]-3-[(E)-2-nitroethenyl]-1H-indol-4-yl] acetate |
| SMILES | COC(=O)N(C)Cc1ccc(-c2[nH]c3cc(F)cc(OC(C)=O)c3c2/C=C/[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H20FN3O6/c1-13(27)32-19-11-16(23)10-18-20(19)17(8-9-26(29)30)21(24-18)15-6-4-14(5-7-15)12-25(2)22(28)31-3/h4-11,24H,12H2,1-3H3/b9-8+ |
| InChIKey | XOAXDTDBPFJWAY-CMDGGOBGSA-N |
| XLogP | 4.34 |
| TPSA | 114.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|