C33H30F5N3O4 — CID 171814408
(2,3,5,6-tetrafluorophenyl) 8-[[4-(6-fluoro-9-oxo-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-2-yl)phenyl]methyl-methylamino]-8-oxooctanoate (PubChem CID 171814408) has the molecular formula C33H30F5N3O4 and a molecular weight of 627.61 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 8-[[4-(6-fluoro-9-oxo-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-2-yl)phenyl]methyl-methylamino]-8-oxooctanoate.
| Compound Name | (2,3,5,6-tetrafluorophenyl) 8-[[4-(6-fluoro-9-oxo-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-2-yl)phenyl]methyl-methylamino]-8-oxooctanoate |
|---|---|
| PubChem CID | 171814408 |
| Molecular Formula | C33H30F5N3O4 |
| Molecular Weight | 627.61 g/mol |
| Exact Mass | 627.22 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 8-[[4-(6-fluoro-9-oxo-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-2-yl)phenyl]methyl-methylamino]-8-oxooctanoate |
| SMILES | CN(Cc1ccc(-c2[nH]c3cc(F)cc4c3c2CCNC4=O)cc1)C(=O)CCCCCCC(=O)Oc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C33H30F5N3O4/c1-41(26(42)6-4-2-3-5-7-27(43)45-32-29(37)23(35)16-24(36)30(32)38)17-18-8-10-19(11-9-18)31-21-12-13-39-33(44)22-14-20(34)15-25(40-31)28(21)22/h8-11,14-16,40H,2-7,12-13,17H2,1H3,(H,39,44) |
| InChIKey | ZPQMTEGSSZLGKN-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.61 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|