C29H30F2N4O3 — CID 175003799
2-[3-[4-(cyclohexanecarbonyl)piperazine-1-carbonyl]-4-fluorophenyl]-6-fluoro-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one (PubChem CID 175003799) has the molecular formula C29H30F2N4O3 and a molecular weight of 520.58 g/mol. Its IUPAC name is 2-[3-[4-(cyclohexanecarbonyl)piperazine-1-carbonyl]-4-fluorophenyl]-6-fluoro-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one.
| Compound Name | 2-[3-[4-(cyclohexanecarbonyl)piperazine-1-carbonyl]-4-fluorophenyl]-6-fluoro-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 175003799 |
| Molecular Formula | C29H30F2N4O3 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | 2-[3-[4-(cyclohexanecarbonyl)piperazine-1-carbonyl]-4-fluorophenyl]-6-fluoro-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one |
| SMILES | O=C1NCCc2c(-c3ccc(F)c(C(=O)N4CCN(C(=O)C5CCCCC5)CC4)c3)[nH]c3cc(F)cc1c23 |
| InChI | InChI=1S/C29H30F2N4O3/c30-19-15-22-25-20(8-9-32-27(22)36)26(33-24(25)16-19)18-6-7-23(31)21(14-18)29(38)35-12-10-34(11-13-35)28(37)17-4-2-1-3-5-17/h6-7,14-17,33H,1-5,8-13H2,(H,32,36) |
| InChIKey | JBZJIOSOZDHQNS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |