C20H27FN2O2 — CID 110366873
2-[4-(cyclohexanecarbonyl)piperazin-1-yl]-1-(2-fluoro-5-methylphenyl)ethanone (PubChem CID 110366873) has the molecular formula C20H27FN2O2 and a molecular weight of 346.45 g/mol. Its IUPAC name is 2-[4-(cyclohexanecarbonyl)piperazin-1-yl]-1-(2-fluoro-5-methylphenyl)ethanone.
| Compound Name | 2-[4-(cyclohexanecarbonyl)piperazin-1-yl]-1-(2-fluoro-5-methylphenyl)ethanone |
|---|---|
| PubChem CID | 110366873 |
| Molecular Formula | C20H27FN2O2 |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 2-[4-(cyclohexanecarbonyl)piperazin-1-yl]-1-(2-fluoro-5-methylphenyl)ethanone |
| SMILES | Cc1ccc(F)c(C(=O)CN2CCN(C(=O)C3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C20H27FN2O2/c1-15-7-8-18(21)17(13-15)19(24)14-22-9-11-23(12-10-22)20(25)16-5-3-2-4-6-16/h7-8,13,16H,2-6,9-12,14H2,1H3 |
| InChIKey | RQBZAXUKHXJCHN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |