C37H36FN5O5S — CID 146184671
2-(2,6-dioxopiperidin-3-yl)-4-[5-[[4-(6-fluoro-9-oxo-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-2-yl)phenyl]methyl-methylamino]pentylsulfanyl]isoindole-1,3-dione (PubChem CID 146184671) has the molecular formula C37H36FN5O5S and a molecular weight of 681.79 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[5-[[4-(6-fluoro-9-oxo-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-2-yl)phenyl]methyl-methylamino]pentylsulfanyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[5-[[4-(6-fluoro-9-oxo-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-2-yl)phenyl]methyl-methylamino]pentylsulfanyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 146184671 |
| Molecular Formula | C37H36FN5O5S |
| Molecular Weight | 681.79 g/mol |
| Exact Mass | 681.24 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[5-[[4-(6-fluoro-9-oxo-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-2-yl)phenyl]methyl-methylamino]pentylsulfanyl]isoindole-1,3-dione |
| SMILES | CN(CCCCCSc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)Cc1ccc(-c2[nH]c3cc(F)cc4c3c2CCNC4=O)cc1 |
| InChI | InChI=1S/C37H36FN5O5S/c1-42(20-21-8-10-22(11-9-21)33-24-14-15-39-34(45)26-18-23(38)19-27(40-33)31(24)26)16-3-2-4-17-49-29-7-5-6-25-32(29)37(48)43(36(25)47)28-12-13-30(44)41-35(28)46/h5-11,18-19,28,40H,2-4,12-17,20H2,1H3,(H,39,45)(H,41,44,46) |
| InChIKey | HSAYVWIPCJBFPC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 131.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.79 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|