C18H16ClNO2 — CID 3817524
2-(3-chloro-4-methoxyphenyl)-4,6-dimethyl-1H-indole-3-carbaldehyde (PubChem CID 3817524) has the molecular formula C18H16ClNO2 and a molecular weight of 313.78 g/mol. Its IUPAC name is 2-(3-chloro-4-methoxyphenyl)-4,6-dimethyl-1H-indole-3-carbaldehyde.
| Compound Name | 2-(3-chloro-4-methoxyphenyl)-4,6-dimethyl-1H-indole-3-carbaldehyde |
|---|---|
| PubChem CID | 3817524 |
| Molecular Formula | C18H16ClNO2 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 2-(3-chloro-4-methoxyphenyl)-4,6-dimethyl-1H-indole-3-carbaldehyde |
| SMILES | COc1ccc(-c2[nH]c3cc(C)cc(C)c3c2C=O)cc1Cl |
| InChI | InChI=1S/C18H16ClNO2/c1-10-6-11(2)17-13(9-21)18(20-15(17)7-10)12-4-5-16(22-3)14(19)8-12/h4-9,20H,1-3H3 |
| InChIKey | ALVMQFNGEPSJAC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|