C16H13NO2 — CID 114063341
2-(2,5-dimethylphenoxy)-5-formylbenzonitrile (PubChem CID 114063341) has the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. Its IUPAC name is 2-(2,5-dimethylphenoxy)-5-formylbenzonitrile.
| Compound Name | 2-(2,5-dimethylphenoxy)-5-formylbenzonitrile |
|---|---|
| PubChem CID | 114063341 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 2-(2,5-dimethylphenoxy)-5-formylbenzonitrile |
| SMILES | Cc1ccc(C)c(Oc2ccc(C=O)cc2C#N)c1 |
| InChI | InChI=1S/C16H13NO2/c1-11-3-4-12(2)16(7-11)19-15-6-5-13(10-18)8-14(15)9-17/h3-8,10H,1-2H3 |
| InChIKey | MPBUQUDAKFYMOL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|