C22H23NO — CID 145267272
4-(2,5-dimethylphenoxy)naphthalene-1-carbonitrile;propane (PubChem CID 145267272) has the molecular formula C22H23NO and a molecular weight of 317.43 g/mol. Its IUPAC name is 4-(2,5-dimethylphenoxy)naphthalene-1-carbonitrile;propane.
| Compound Name | 4-(2,5-dimethylphenoxy)naphthalene-1-carbonitrile;propane |
|---|---|
| PubChem CID | 145267272 |
| Molecular Formula | C22H23NO |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 4-(2,5-dimethylphenoxy)naphthalene-1-carbonitrile;propane |
| SMILES | CCC.Cc1ccc(C)c(Oc2ccc(C#N)c3ccccc23)c1 |
| InChI | InChI=1S/C19H15NO.C3H8/c1-13-7-8-14(2)19(11-13)21-18-10-9-15(12-20)16-5-3-4-6-17(16)18;1-3-2/h3-11H,1-2H3;3H2,1-2H3 |
| InChIKey | TVFNBYUYRAGFCE-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |