C18H17NO3 — CID 67803258
2-[2-(3,4-dimethoxyphenyl)ethenyl]-5-methoxybenzonitrile (PubChem CID 67803258) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)ethenyl]-5-methoxybenzonitrile.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)ethenyl]-5-methoxybenzonitrile |
|---|---|
| PubChem CID | 67803258 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)ethenyl]-5-methoxybenzonitrile |
| SMILES | COc1ccc(C=Cc2ccc(OC)c(OC)c2)c(C#N)c1 |
| InChI | InChI=1S/C18H17NO3/c1-20-16-8-7-14(15(11-16)12-19)6-4-13-5-9-17(21-2)18(10-13)22-3/h4-11H,1-3H3 |
| InChIKey | HSAVKTMOAYXNGM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|