C16H18N2O2 — CID 86013631
4-[2-(3,4-dimethoxyphenyl)ethenyl]benzene-1,3-diamine (PubChem CID 86013631) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 4-[2-(3,4-dimethoxyphenyl)ethenyl]benzene-1,3-diamine.
| Compound Name | 4-[2-(3,4-dimethoxyphenyl)ethenyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 86013631 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 4-[2-(3,4-dimethoxyphenyl)ethenyl]benzene-1,3-diamine |
| SMILES | COc1ccc(C=Cc2ccc(N)cc2N)cc1OC |
| InChI | InChI=1S/C16H18N2O2/c1-19-15-8-4-11(9-16(15)20-2)3-5-12-6-7-13(17)10-14(12)18/h3-10H,17-18H2,1-2H3 |
| InChIKey | KLILLYUMRQVNNU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|