C18H17F3N4O4 — CID 85065873
2-amino-3-[4-[4-(diaminomethylidenecarbamoyl)-2-(trifluoromethyl)phenoxy]phenyl]propanoic acid (PubChem CID 85065873) has the molecular formula C18H17F3N4O4 and a molecular weight of 410.35 g/mol. Its IUPAC name is 2-amino-3-[4-[4-(diaminomethylidenecarbamoyl)-2-(trifluoromethyl)phenoxy]phenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-[4-(diaminomethylidenecarbamoyl)-2-(trifluoromethyl)phenoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 85065873 |
| Molecular Formula | C18H17F3N4O4 |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 2-amino-3-[4-[4-(diaminomethylidenecarbamoyl)-2-(trifluoromethyl)phenoxy]phenyl]propanoic acid |
| SMILES | NC(N)=NC(=O)c1ccc(Oc2ccc(CC(N)C(=O)O)cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H17F3N4O4/c19-18(20,21)12-8-10(15(26)25-17(23)24)3-6-14(12)29-11-4-1-9(2-5-11)7-13(22)16(27)28/h1-6,8,13H,7,22H2,(H,27,28)(H4,23,24,25,26) |
| InChIKey | BYAYSHQTKWHKIO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 154.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|