C18H19F3N4O4S — CID 23302063
4-[4-(1-aminoethylsulfonylmethyl)phenoxy]-N-(diaminomethylidene)-3-(trifluoromethyl)benzamide (PubChem CID 23302063) has the molecular formula C18H19F3N4O4S and a molecular weight of 444.44 g/mol. Its IUPAC name is 4-[4-(1-aminoethylsulfonylmethyl)phenoxy]-N-(diaminomethylidene)-3-(trifluoromethyl)benzamide.
| Compound Name | 4-[4-(1-aminoethylsulfonylmethyl)phenoxy]-N-(diaminomethylidene)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 23302063 |
| Molecular Formula | C18H19F3N4O4S |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 4-[4-(1-aminoethylsulfonylmethyl)phenoxy]-N-(diaminomethylidene)-3-(trifluoromethyl)benzamide |
| SMILES | CC(N)S(=O)(=O)Cc1ccc(Oc2ccc(C(=O)N=C(N)N)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H19F3N4O4S/c1-10(22)30(27,28)9-11-2-5-13(6-3-11)29-15-7-4-12(16(26)25-17(23)24)8-14(15)18(19,20)21/h2-8,10H,9,22H2,1H3,(H4,23,24,25,26) |
| InChIKey | YRTHWOWGIVSVCD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 150.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|