C19H14F2N2O6 — CID 22669075
2-amino-3-[4-[4-[(Z)-(2,4-dioxo-1,3-oxazolidin-5-ylidene)methyl]phenoxy]-2,3-difluorophenyl]propanoic acid (PubChem CID 22669075) has the molecular formula C19H14F2N2O6 and a molecular weight of 404.33 g/mol. Its IUPAC name is 2-amino-3-[4-[4-[(Z)-(2,4-dioxo-1,3-oxazolidin-5-ylidene)methyl]phenoxy]-2,3-difluorophenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-[4-[(Z)-(2,4-dioxo-1,3-oxazolidin-5-ylidene)methyl]phenoxy]-2,3-difluorophenyl]propanoic acid |
|---|---|
| PubChem CID | 22669075 |
| Molecular Formula | C19H14F2N2O6 |
| Molecular Weight | 404.33 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 2-amino-3-[4-[4-[(Z)-(2,4-dioxo-1,3-oxazolidin-5-ylidene)methyl]phenoxy]-2,3-difluorophenyl]propanoic acid |
| SMILES | NC(Cc1ccc(Oc2ccc(/C=C3\OC(=O)NC3=O)cc2)c(F)c1F)C(=O)O |
| InChI | InChI=1S/C19H14F2N2O6/c20-15-10(8-12(22)18(25)26)3-6-13(16(15)21)28-11-4-1-9(2-5-11)7-14-17(24)23-19(27)29-14/h1-7,12H,8,22H2,(H,25,26)(H,23,24,27)/b14-7- |
| InChIKey | AZQWPPHHHRHWSZ-AUWJEWJLSA-N |
| XLogP | 2.32 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|