C21H19NO3 — CID 51140286
2-(1-formylnaphthalen-2-yl)oxy-N-(1-phenylethyl)acetamide (PubChem CID 51140286) has the molecular formula C21H19NO3 and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-(1-formylnaphthalen-2-yl)oxy-N-(1-phenylethyl)acetamide.
| Compound Name | 2-(1-formylnaphthalen-2-yl)oxy-N-(1-phenylethyl)acetamide |
|---|---|
| PubChem CID | 51140286 |
| Molecular Formula | C21H19NO3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 2-(1-formylnaphthalen-2-yl)oxy-N-(1-phenylethyl)acetamide |
| SMILES | CC(NC(=O)COc1ccc2ccccc2c1C=O)c1ccccc1 |
| InChI | InChI=1S/C21H19NO3/c1-15(16-7-3-2-4-8-16)22-21(24)14-25-20-12-11-17-9-5-6-10-18(17)19(20)13-23/h2-13,15H,14H2,1H3,(H,22,24) |
| InChIKey | WJIYPPXUMXMKMX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|