C18H21NO3 — CID 9010002
2-(1-formylnaphthalen-2-yl)oxy-N-(2-methylbutan-2-yl)acetamide (PubChem CID 9010002) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-(1-formylnaphthalen-2-yl)oxy-N-(2-methylbutan-2-yl)acetamide.
| Compound Name | 2-(1-formylnaphthalen-2-yl)oxy-N-(2-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 9010002 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 2-(1-formylnaphthalen-2-yl)oxy-N-(2-methylbutan-2-yl)acetamide |
| SMILES | CCC(C)(C)NC(=O)COc1ccc2ccccc2c1C=O |
| InChI | InChI=1S/C18H21NO3/c1-4-18(2,3)19-17(21)12-22-16-10-9-13-7-5-6-8-14(13)15(16)11-20/h5-11H,4,12H2,1-3H3,(H,19,21) |
| InChIKey | XIGSURJIXDYVSR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|