C20H16ClNO3 — CID 7763455
N-[(4-chlorophenyl)methyl]-2-(1-formylnaphthalen-2-yl)oxyacetamide (PubChem CID 7763455) has the molecular formula C20H16ClNO3 and a molecular weight of 353.81 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-(1-formylnaphthalen-2-yl)oxyacetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-(1-formylnaphthalen-2-yl)oxyacetamide |
|---|---|
| PubChem CID | 7763455 |
| Molecular Formula | C20H16ClNO3 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-(1-formylnaphthalen-2-yl)oxyacetamide |
| SMILES | O=Cc1c(OCC(=O)NCc2ccc(Cl)cc2)ccc2ccccc12 |
| InChI | InChI=1S/C20H16ClNO3/c21-16-8-5-14(6-9-16)11-22-20(24)13-25-19-10-7-15-3-1-2-4-17(15)18(19)12-23/h1-10,12H,11,13H2,(H,22,24) |
| InChIKey | LSAFLWLDGVJXBE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|