C24H24BrN3O4 — CID 67040083
tert-butyl N-[4-[2-amino-4-[(4-bromophenyl)carbamoyl]phenoxy]phenyl]carbamate (PubChem CID 67040083) has the molecular formula C24H24BrN3O4 and a molecular weight of 498.38 g/mol. Its IUPAC name is tert-butyl N-[4-[2-amino-4-[(4-bromophenyl)carbamoyl]phenoxy]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-amino-4-[(4-bromophenyl)carbamoyl]phenoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 67040083 |
| Molecular Formula | C24H24BrN3O4 |
| Molecular Weight | 498.38 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | tert-butyl N-[4-[2-amino-4-[(4-bromophenyl)carbamoyl]phenoxy]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Oc2ccc(C(=O)Nc3ccc(Br)cc3)cc2N)cc1 |
| InChI | InChI=1S/C24H24BrN3O4/c1-24(2,3)32-23(30)28-18-9-11-19(12-10-18)31-21-13-4-15(14-20(21)26)22(29)27-17-7-5-16(25)6-8-17/h4-14H,26H2,1-3H3,(H,27,29)(H,28,30) |
| InChIKey | HBGULSQYIPUSEY-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.38 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|