C25H24F3N3O4 — CID 91229132
tert-butyl N-[4-[2-amino-4-[phenyl(trifluoromethyl)carbamoyl]phenoxy]phenyl]carbamate (PubChem CID 91229132) has the molecular formula C25H24F3N3O4 and a molecular weight of 487.48 g/mol. Its IUPAC name is tert-butyl N-[4-[2-amino-4-[phenyl(trifluoromethyl)carbamoyl]phenoxy]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-amino-4-[phenyl(trifluoromethyl)carbamoyl]phenoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 91229132 |
| Molecular Formula | C25H24F3N3O4 |
| Molecular Weight | 487.48 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | tert-butyl N-[4-[2-amino-4-[phenyl(trifluoromethyl)carbamoyl]phenoxy]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Oc2ccc(C(=O)N(c3ccccc3)C(F)(F)F)cc2N)cc1 |
| InChI | InChI=1S/C25H24F3N3O4/c1-24(2,3)35-23(33)30-17-10-12-19(13-11-17)34-21-14-9-16(15-20(21)29)22(32)31(25(26,27)28)18-7-5-4-6-8-18/h4-15H,29H2,1-3H3,(H,30,33) |
| InChIKey | SHEIBLHFSIMZRB-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.48 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|