C23H23FN4O4 — CID 90819672
tert-butyl N-[4-[2-amino-4-[fluoro(pyridin-2-yl)carbamoyl]phenoxy]phenyl]carbamate (PubChem CID 90819672) has the molecular formula C23H23FN4O4 and a molecular weight of 438.46 g/mol. Its IUPAC name is tert-butyl N-[4-[2-amino-4-[fluoro(pyridin-2-yl)carbamoyl]phenoxy]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-amino-4-[fluoro(pyridin-2-yl)carbamoyl]phenoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 90819672 |
| Molecular Formula | C23H23FN4O4 |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | tert-butyl N-[4-[2-amino-4-[fluoro(pyridin-2-yl)carbamoyl]phenoxy]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Oc2ccc(C(=O)N(F)c3ccccn3)cc2N)cc1 |
| InChI | InChI=1S/C23H23FN4O4/c1-23(2,3)32-22(30)27-16-8-10-17(11-9-16)31-19-12-7-15(14-18(19)25)21(29)28(24)20-6-4-5-13-26-20/h4-14H,25H2,1-3H3,(H,27,30) |
| InChIKey | KDFOPCRMMYRDTR-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|