C26H30N2 — CID 12857182
6,13-ditert-butyltricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene-15,16-dicarbonitrile (PubChem CID 12857182) has the molecular formula C26H30N2 and a molecular weight of 370.54 g/mol. Its IUPAC name is 6,13-ditert-butyltricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene-15,16-dicarbonitrile.
| Compound Name | 6,13-ditert-butyltricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene-15,16-dicarbonitrile |
|---|---|
| PubChem CID | 12857182 |
| Molecular Formula | C26H30N2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 6,13-ditert-butyltricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene-15,16-dicarbonitrile |
| SMILES | CC(C)(C)c1cc2c(C#N)c(c1)CCc1cc(C(C)(C)C)cc(c1C#N)CC2 |
| InChI | InChI=1S/C26H30N2/c1-25(2,3)21-11-17-7-9-19-13-22(26(4,5)6)14-20(24(19)16-28)10-8-18(12-21)23(17)15-27/h11-14H,7-10H2,1-6H3 |
| InChIKey | JXWBNCIHFGJHMP-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |