About (4-tert-butyl-2,6-dimethylphenyl)-(oxiran-2-yl)methanone
(4-tert-butyl-2,6-dimethylphenyl)-(oxiran-2-yl)methanone (PubChem CID 116826456) has the molecular formula C15H20O2
and a molecular weight of 232.32 g/mol. Its IUPAC name is (4-tert-butyl-2,6-dimethylphenyl)-(oxiran-2-yl)methanone.
Molecular Properties
| Compound Name | (4-tert-butyl-2,6-dimethylphenyl)-(oxiran-2-yl)methanone |
| PubChem CID | 116826456 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (4-tert-butyl-2,6-dimethylphenyl)-(oxiran-2-yl)methanone |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1C(=O)C1CO1 |
| InChI | InChI=1S/C15H20O2/c1-9-6-11(15(3,4)5)7-10(2)13(9)14(16)12-8-17-12/h6-7,12H,8H2,1-5H3 |
| InChIKey | JGKQMTVUUMUKEZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (4-tert-butyl-2,6-dimethylphenyl)-(oxiran-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-tert-butyl-2,6-dimethylphenyl)-(oxiran-2-yl)methanone?
The IUPAC name of (4-tert-butyl-2,6-dimethylphenyl)-(oxiran-2-yl)methanone (CID 116826456) is (4-tert-butyl-2,6-dimethylphenyl)-(oxiran-2-yl)methanone.
What is the SMILES notation for (4-tert-butyl-2,6-dimethylphenyl)-(oxiran-2-yl)methanone?
The canonical SMILES for (4-tert-butyl-2,6-dimethylphenyl)-(oxiran-2-yl)methanone is Cc1cc(C(C)(C)C)cc(C)c1C(=O)C1CO1.
What is the InChIKey of (4-tert-butyl-2,6-dimethylphenyl)-(oxiran-2-yl)methanone?
The InChIKey is JGKQMTVUUMUKEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O2/c1-9-6-11(15(3,4)5)7-10(2)13(9)14(16)12-8-17-12/h6-7,12H,8H2,1-5H3.
What are the key properties of (4-tert-butyl-2,6-dimethylphenyl)-(oxiran-2-yl)methanone?
(4-tert-butyl-2,6-dimethylphenyl)-(oxiran-2-yl)methanone has a molecular weight of 232.32 g/mol, XLogP of 3.18, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-tert-butyl-2,6-dimethylphenyl)-(oxiran-2-yl)methanone is sourced from PubChem (CID 116826456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).