C17H27OP — CID 174463873
1-(4-tert-butyl-2,6-dimethylphenyl)-3-methyl-2-phosphanylbutan-1-one (PubChem CID 174463873) has the molecular formula C17H27OP and a molecular weight of 278.38 g/mol. Its IUPAC name is 1-(4-tert-butyl-2,6-dimethylphenyl)-3-methyl-2-phosphanylbutan-1-one.
| Compound Name | 1-(4-tert-butyl-2,6-dimethylphenyl)-3-methyl-2-phosphanylbutan-1-one |
|---|---|
| PubChem CID | 174463873 |
| Molecular Formula | C17H27OP |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 1-(4-tert-butyl-2,6-dimethylphenyl)-3-methyl-2-phosphanylbutan-1-one |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1C(=O)C(P)C(C)C |
| InChI | InChI=1S/C17H27OP/c1-10(2)16(19)15(18)14-11(3)8-13(9-12(14)4)17(5,6)7/h8-10,16H,19H2,1-7H3 |
| InChIKey | RULZIFGNYJNAHE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|