C14H17NO — CID 116918980
4-tert-butyl-2,6-dimethylbenzoyl cyanide (PubChem CID 116918980) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 4-tert-butyl-2,6-dimethylbenzoyl cyanide.
| Compound Name | 4-tert-butyl-2,6-dimethylbenzoyl cyanide |
|---|---|
| PubChem CID | 116918980 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 4-tert-butyl-2,6-dimethylbenzoyl cyanide |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1C(=O)C#N |
| InChI | InChI=1S/C14H17NO/c1-9-6-11(14(3,4)5)7-10(2)13(9)12(16)8-15/h6-7H,1-5H3 |
| InChIKey | OIXMNGNVPGFJIO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|