About 3-hydroxybenzoyl isocyanide
3-hydroxybenzoyl isocyanide (PubChem CID 162773035) has the molecular formula C8H5NO2
and a molecular weight of 147.13 g/mol. Its IUPAC name is 3-hydroxybenzoyl isocyanide.
Molecular Properties
| Compound Name | 3-hydroxybenzoyl isocyanide |
| PubChem CID | 162773035 |
| Molecular Formula | C8H5NO2 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.03 |
| IUPAC Name | 3-hydroxybenzoyl isocyanide |
| SMILES | [C-]#[N+]C(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C8H5NO2/c1-9-8(11)6-3-2-4-7(10)5-6/h2-5,10H |
| InChIKey | ZVDJAAOOYQBJGL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 41.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxybenzoyl isocyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxybenzoyl isocyanide?
The IUPAC name of 3-hydroxybenzoyl isocyanide (CID 162773035) is 3-hydroxybenzoyl isocyanide.
What is the SMILES notation for 3-hydroxybenzoyl isocyanide?
The canonical SMILES for 3-hydroxybenzoyl isocyanide is [C-]#[N+]C(=O)c1cccc(O)c1.
What is the InChIKey of 3-hydroxybenzoyl isocyanide?
The InChIKey is ZVDJAAOOYQBJGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO2/c1-9-8(11)6-3-2-4-7(10)5-6/h2-5,10H.
What are the key properties of 3-hydroxybenzoyl isocyanide?
3-hydroxybenzoyl isocyanide has a molecular weight of 147.13 g/mol, XLogP of 1.45, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxybenzoyl isocyanide is sourced from PubChem (CID 162773035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).