C10H8F3N3O4 — CID 162327714
3-cyano-4-hydroxybenzohydrazide;2,2,2-trifluoroacetic acid (PubChem CID 162327714) has the molecular formula C10H8F3N3O4 and a molecular weight of 291.19 g/mol. Its IUPAC name is 3-cyano-4-hydroxybenzohydrazide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-cyano-4-hydroxybenzohydrazide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 162327714 |
| Molecular Formula | C10H8F3N3O4 |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 3-cyano-4-hydroxybenzohydrazide;2,2,2-trifluoroacetic acid |
| SMILES | N#Cc1cc(C(=O)NN)ccc1O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C8H7N3O2.C2HF3O2/c9-4-6-3-5(8(13)11-10)1-2-7(6)12;3-2(4,5)1(6)7/h1-3,12H,10H2,(H,11,13);(H,6,7) |
| InChIKey | XFZDQNRXIAEQBI-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 136.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|