C26H12F10N2O3 — CID 142665451
3-hydroxy-2-N,7-N-bis[2,3,5,6-tetrafluoro-4-(fluoromethyl)phenyl]naphthalene-2,7-dicarboxamide (PubChem CID 142665451) has the molecular formula C26H12F10N2O3 and a molecular weight of 590.37 g/mol. Its IUPAC name is 3-hydroxy-2-N,7-N-bis[2,3,5,6-tetrafluoro-4-(fluoromethyl)phenyl]naphthalene-2,7-dicarboxamide.
| Compound Name | 3-hydroxy-2-N,7-N-bis[2,3,5,6-tetrafluoro-4-(fluoromethyl)phenyl]naphthalene-2,7-dicarboxamide |
|---|---|
| PubChem CID | 142665451 |
| Molecular Formula | C26H12F10N2O3 |
| Molecular Weight | 590.37 g/mol |
| Exact Mass | 590.07 |
| IUPAC Name | 3-hydroxy-2-N,7-N-bis[2,3,5,6-tetrafluoro-4-(fluoromethyl)phenyl]naphthalene-2,7-dicarboxamide |
| SMILES | O=C(Nc1c(F)c(F)c(CF)c(F)c1F)c1ccc2cc(O)c(C(=O)Nc3c(F)c(F)c(CF)c(F)c3F)cc2c1 |
| InChI | InChI=1S/C26H12F10N2O3/c27-6-12-15(29)19(33)23(20(34)16(12)30)37-25(40)9-2-1-8-5-14(39)11(4-10(8)3-9)26(41)38-24-21(35)17(31)13(7-28)18(32)22(24)36/h1-5,39H,6-7H2,(H,37,40)(H,38,41) |
| InChIKey | IYKSLSKZZCQEPJ-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.37 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|